C28H42O4SSi — CID 11260600
(4aR,4bR,8aS,10aS)-8a-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-2,3,4,4b,5,8,10,10a-octahydro-1H-phenanthren-9-one (PubChem CID 11260600) has the molecular formula C28H42O4SSi and a molecular weight of 502.79 g/mol. Its IUPAC name is (4aR,4bR,8aS,10aS)-8a-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-2,3,4,4b,5,8,10,10a-octahydro-1H-phenanthren-9-one.
| Compound Name | (4aR,4bR,8aS,10aS)-8a-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-2,3,4,4b,5,8,10,10a-octahydro-1H-phenanthren-9-one |
|---|---|
| PubChem CID | 11260600 |
| Molecular Formula | C28H42O4SSi |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (4aR,4bR,8aS,10aS)-8a-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-4a,7-dimethyl-2,3,4,4b,5,8,10,10a-octahydro-1H-phenanthren-9-one |
| SMILES | CC1=C(O[Si](C)(C)C(C)(C)C)C[C@@H]2[C@]3(C)CCCC[C@H]3CC(=O)[C@]2(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H42O4SSi/c1-20-19-28(33(30,31)22-14-9-8-10-15-22)24(18-23(20)32-34(6,7)26(2,3)4)27(5)16-12-11-13-21(27)17-25(28)29/h8-10,14-15,21,24H,11-13,16-19H2,1-7H3/t21-,24+,27+,28-/m0/s1 |
| InChIKey | GYKPFBNSDONBPP-JFECRIIYSA-N |
| XLogP | 7.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|