C24H32O6S — CID 10765893
methyl (1R,4aR,8aS)-6-(benzenesulfonyl)-1,4a-dimethyl-5-oxo-6-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 10765893) has the molecular formula C24H32O6S and a molecular weight of 448.58 g/mol. Its IUPAC name is methyl (1R,4aR,8aS)-6-(benzenesulfonyl)-1,4a-dimethyl-5-oxo-6-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1R,4aR,8aS)-6-(benzenesulfonyl)-1,4a-dimethyl-5-oxo-6-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10765893 |
| Molecular Formula | C24H32O6S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | methyl (1R,4aR,8aS)-6-(benzenesulfonyl)-1,4a-dimethyl-5-oxo-6-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C(=O)C(CCC(C)=O)(S(=O)(=O)c3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C24H32O6S/c1-17(25)11-15-24(31(28,29)18-9-6-5-7-10-18)16-12-19-22(2,20(24)26)13-8-14-23(19,3)21(27)30-4/h5-7,9-10,19H,8,11-16H2,1-4H3/t19-,22+,23+,24?/m0/s1 |
| InChIKey | XTAVZVZHIQGERM-ROWLDYROSA-N |
| XLogP | 3.92 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |