C16H19FO5S — CID 67266822
methyl 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)propanoate (PubChem CID 67266822) has the molecular formula C16H19FO5S and a molecular weight of 342.39 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)propanoate.
| Compound Name | methyl 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)propanoate |
|---|---|
| PubChem CID | 67266822 |
| Molecular Formula | C16H19FO5S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl 2-(4-fluorophenyl)sulfonyl-2-(3-oxocyclohexyl)propanoate |
| SMILES | COC(=O)C(C)(C1CCCC(=O)C1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FO5S/c1-16(15(19)22-2,11-4-3-5-13(18)10-11)23(20,21)14-8-6-12(17)7-9-14/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | XIJNJHFSZCGHKL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |