C21H22F2O4S — CID 163297795
trans-[5-(benzenesulfonyl)-5,5-difluoropentyl] (1R,2R)-2-phenylcyclopropane-1-carboxylate (PubChem CID 163297795) has the molecular formula C21H22F2O4S and a molecular weight of 408.47 g/mol. Its IUPAC name is trans-[5-(benzenesulfonyl)-5,5-difluoropentyl] (1R,2R)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | trans-[5-(benzenesulfonyl)-5,5-difluoropentyl] (1R,2R)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163297795 |
| Molecular Formula | C21H22F2O4S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | trans-[5-(benzenesulfonyl)-5,5-difluoropentyl] (1R,2R)-2-phenylcyclopropane-1-carboxylate |
| SMILES | O=C(OCCCCC(F)(F)S(=O)(=O)c1ccccc1)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22F2O4S/c22-21(23,28(25,26)17-11-5-2-6-12-17)13-7-8-14-27-20(24)19-15-18(19)16-9-3-1-4-10-16/h1-6,9-12,18-19H,7-8,13-15H2/t18-,19+/m0/s1 |
| InChIKey | PSHDYRPVJKPPFG-RBUKOAKNSA-N |
| XLogP | 4.57 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|