C24H30F2O4S — CID 163297650
[5-(benzenesulfonyl)-5,5-difluoropentyl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 163297650) has the molecular formula C24H30F2O4S and a molecular weight of 452.56 g/mol. Its IUPAC name is [5-(benzenesulfonyl)-5,5-difluoropentyl] 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 163297650 |
| Molecular Formula | C24H30F2O4S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [5-(benzenesulfonyl)-5,5-difluoropentyl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)OCCCCC(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H30F2O4S/c1-18(2)17-20-11-13-21(14-12-20)19(3)23(27)30-16-8-7-15-24(25,26)31(28,29)22-9-5-4-6-10-22/h4-6,9-14,18-19H,7-8,15-17H2,1-3H3 |
| InChIKey | COERUBJRBQJUAN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|