C17H24F2O4S — CID 164675596
ethyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloctanoate (PubChem CID 164675596) has the molecular formula C17H24F2O4S and a molecular weight of 362.44 g/mol. Its IUPAC name is ethyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloctanoate.
| Compound Name | ethyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloctanoate |
|---|---|
| PubChem CID | 164675596 |
| Molecular Formula | C17H24F2O4S |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl 2,2-difluoro-8-(4-methylphenyl)sulfonyloctanoate |
| SMILES | CCOC(=O)C(F)(F)CCCCCCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24F2O4S/c1-3-23-16(20)17(18,19)12-6-4-5-7-13-24(21,22)15-10-8-14(2)9-11-15/h8-11H,3-7,12-13H2,1-2H3 |
| InChIKey | OSVVPYNGILGEGF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|