C17H10F17NO4S — CID 10841917
2-(4-sulfamoylphenyl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate (PubChem CID 10841917) has the molecular formula C17H10F17NO4S and a molecular weight of 647.30 g/mol. Its IUPAC name is 2-(4-sulfamoylphenyl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate.
| Compound Name | 2-(4-sulfamoylphenyl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
|---|---|
| PubChem CID | 10841917 |
| Molecular Formula | C17H10F17NO4S |
| Molecular Weight | 647.30 g/mol |
| Exact Mass | 647.01 |
| IUPAC Name | 2-(4-sulfamoylphenyl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
| SMILES | NS(=O)(=O)c1ccc(CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F17NO4S/c18-10(19,9(36)39-6-5-7-1-3-8(4-2-7)40(35,37)38)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h1-4H,5-6H2,(H2,35,37,38) |
| InChIKey | MTZMWJBQGHZLAD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.30 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|