C12H10F9NO5S2 — CID 10648512
2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 10648512) has the molecular formula C12H10F9NO5S2 and a molecular weight of 483.33 g/mol. Its IUPAC name is 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 10648512 |
| Molecular Formula | C12H10F9NO5S2 |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 2-(4-sulfamoylphenyl)ethyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | NS(=O)(=O)c1ccc(CCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F9NO5S2/c13-9(14,11(17,18)19)10(15,16)12(20,21)29(25,26)27-6-5-7-1-3-8(4-2-7)28(22,23)24/h1-4H,5-6H2,(H2,22,23,24) |
| InChIKey | FSOKMKXZLMINMN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|