C13H8F5NO5S2 — CID 10788101
(4-sulfamoylphenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 10788101) has the molecular formula C13H8F5NO5S2 and a molecular weight of 417.33 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (4-sulfamoylphenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 10788101 |
| Molecular Formula | C13H8F5NO5S2 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | NS(=O)(=O)c1ccc(COS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H8F5NO5S2/c14-8-9(15)11(17)13(12(18)10(8)16)26(22,23)24-5-6-1-3-7(4-2-6)25(19,20)21/h1-4H,5H2,(H2,19,20,21) |
| InChIKey | GODTZJVEBHTHTO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|