C20H26O4S — CID 44580244
(3S,4R,5R)-3-(benzenesulfonyl)-3-but-3-enyl-4-prop-2-enyl-5-propyloxolan-2-one (PubChem CID 44580244) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-3-but-3-enyl-4-prop-2-enyl-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-3-but-3-enyl-4-prop-2-enyl-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 44580244 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-3-but-3-enyl-4-prop-2-enyl-5-propyloxolan-2-one |
| SMILES | C=CCC[C@@]1(S(=O)(=O)c2ccccc2)C(=O)O[C@H](CCC)[C@H]1CC=C |
| InChI | InChI=1S/C20H26O4S/c1-4-7-15-20(25(22,23)16-13-9-8-10-14-16)17(11-5-2)18(12-6-3)24-19(20)21/h4-5,8-10,13-14,17-18H,1-2,6-7,11-12,15H2,3H3/t17-,18-,20+/m1/s1 |
| InChIKey | YNKIVQLTPVEJCT-GGPKGHCWSA-N |
| XLogP | 4.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|