C21H30O3SSi — CID 100952100
(3R)-3-(benzenesulfonyl)-3-[2-(trimethylsilylmethyl)prop-2-enyl]bicyclo[2.2.2]octan-2-one (PubChem CID 100952100) has the molecular formula C21H30O3SSi and a molecular weight of 390.62 g/mol. Its IUPAC name is (3R)-3-(benzenesulfonyl)-3-[2-(trimethylsilylmethyl)prop-2-enyl]bicyclo[2.2.2]octan-2-one.
| Compound Name | (3R)-3-(benzenesulfonyl)-3-[2-(trimethylsilylmethyl)prop-2-enyl]bicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 100952100 |
| Molecular Formula | C21H30O3SSi |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (3R)-3-(benzenesulfonyl)-3-[2-(trimethylsilylmethyl)prop-2-enyl]bicyclo[2.2.2]octan-2-one |
| SMILES | C=C(C[C@]1(S(=O)(=O)c2ccccc2)C(=O)C2CCC1CC2)C[Si](C)(C)C |
| InChI | InChI=1S/C21H30O3SSi/c1-16(15-26(2,3)4)14-21(18-12-10-17(11-13-18)20(21)22)25(23,24)19-8-6-5-7-9-19/h5-9,17-18H,1,10-15H2,2-4H3/t17?,18?,21-/m1/s1 |
| InChIKey | XSLMVCQQRYUUSB-WIXQSORDSA-N |
| XLogP | 4.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|