C34H38O4SSi — CID 101463188
(1S,2S,6S,10R)-2-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one (PubChem CID 101463188) has the molecular formula C34H38O4SSi and a molecular weight of 570.83 g/mol. Its IUPAC name is (1S,2S,6S,10R)-2-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one.
| Compound Name | (1S,2S,6S,10R)-2-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one |
|---|---|
| PubChem CID | 101463188 |
| Molecular Formula | C34H38O4SSi |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (1S,2S,6S,10R)-2-(benzenesulfonyl)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one |
| SMILES | CC(C)(C)[Si](OCC[C@@]12C=CC[C@@H]3[C@@H]1[C@]3(S(=O)(=O)c1ccccc1)C(=O)CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O4SSi/c1-32(2,3)40(27-16-9-5-10-17-27,28-18-11-6-12-19-28)38-25-24-33-22-13-20-29-31(33)34(29,30(35)21-23-33)39(36,37)26-14-7-4-8-15-26/h4-19,22,29,31H,20-21,23-25H2,1-3H3/t29-,31+,33+,34-/m1/s1 |
| InChIKey | YIWFDMQPALKZNB-NQCMMUDKSA-N |
| XLogP | 5.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|