C38H44O2SSi — CID 11146374
(3S,3aR,5aS,8aR,8bR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-phenylsulfanyl-8b-prop-2-enyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one (PubChem CID 11146374) has the molecular formula C38H44O2SSi and a molecular weight of 592.92 g/mol. Its IUPAC name is (3S,3aR,5aS,8aR,8bR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-phenylsulfanyl-8b-prop-2-enyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one.
| Compound Name | (3S,3aR,5aS,8aR,8bR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-phenylsulfanyl-8b-prop-2-enyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one |
|---|---|
| PubChem CID | 11146374 |
| Molecular Formula | C38H44O2SSi |
| Molecular Weight | 592.92 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | (3S,3aR,5aS,8aR,8bR)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-8-phenylsulfanyl-8b-prop-2-enyl-1,2,3,3a,4,5a,6,8a-octahydroacenaphthylen-5-one |
| SMILES | C=CC[C@@]12[C@@H]3CC=C(Sc4ccccc4)[C@@H]1CC[C@@H]2[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC3=O |
| InChI | InChI=1S/C38H44O2SSi/c1-5-25-38-32-21-22-34(38)36(41-29-15-9-6-10-16-29)24-23-33(38)35(39)26-28(32)27-40-42(37(2,3)4,30-17-11-7-12-18-30)31-19-13-8-14-20-31/h5-20,24,28,32-34H,1,21-23,25-27H2,2-4H3/t28-,32-,33-,34+,38-/m1/s1 |
| InChIKey | DOPXYEIKEOOBQS-LFZQUHGESA-N |
| XLogP | 8.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.92 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|