C40H44O4S2Si — CID 134837526
(1R,4aS,8R,8aR)-1-(benzenesulfonyl)-4a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-phenylsulfanyl-1,3,4,7,8,8a-hexahydronaphthalen-2-one (PubChem CID 134837526) has the molecular formula C40H44O4S2Si and a molecular weight of 681.01 g/mol. Its IUPAC name is (1R,4aS,8R,8aR)-1-(benzenesulfonyl)-4a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-phenylsulfanyl-1,3,4,7,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (1R,4aS,8R,8aR)-1-(benzenesulfonyl)-4a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-phenylsulfanyl-1,3,4,7,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 134837526 |
| Molecular Formula | C40H44O4S2Si |
| Molecular Weight | 681.01 g/mol |
| Exact Mass | 680.25 |
| IUPAC Name | (1R,4aS,8R,8aR)-1-(benzenesulfonyl)-4a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-8-phenylsulfanyl-1,3,4,7,8,8a-hexahydronaphthalen-2-one |
| SMILES | CC(C)(C)[Si](OCC[C@@]12C=CC[C@@H](Sc3ccccc3)[C@@H]1[C@@H](S(=O)(=O)c1ccccc1)C(=O)CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44O4S2Si/c1-39(2,3)47(33-21-12-6-13-22-33,34-23-14-7-15-24-34)44-30-29-40-27-16-25-36(45-31-17-8-4-9-18-31)37(40)38(35(41)26-28-40)46(42,43)32-19-10-5-11-20-32/h4-24,27,36-38H,25-26,28-30H2,1-3H3/t36-,37-,38+,40+/m1/s1 |
| InChIKey | CHDIEYAOBFYZLK-IANLCWGBSA-N |
| XLogP | 7.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.01 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|