C41H48O6SSi — CID 101499623
(1R,5R)-2-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4,4-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-6-ene-3,9-dione (PubChem CID 101499623) has the molecular formula C41H48O6SSi and a molecular weight of 696.98 g/mol. Its IUPAC name is (1R,5R)-2-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4,4-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-6-ene-3,9-dione.
| Compound Name | (1R,5R)-2-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4,4-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-6-ene-3,9-dione |
|---|---|
| PubChem CID | 101499623 |
| Molecular Formula | C41H48O6SSi |
| Molecular Weight | 696.98 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | (1R,5R)-2-(benzenesulfonyl)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-4,4-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-6-ene-3,9-dione |
| SMILES | C=CCC1=C(OC)[C@@]2(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(=O)[C@@](CC=C)(C1)C(S(=O)(=O)c1ccccc1)C(=O)C2(C)C |
| InChI | InChI=1S/C41H48O6SSi/c1-9-20-30-28-40(27-10-2)36(48(44,45)31-21-14-11-15-22-31)34(42)39(6,7)41(37(40)43,35(30)46-8)29-47-49(38(3,4)5,32-23-16-12-17-24-32)33-25-18-13-19-26-33/h9-19,21-26,36H,1-2,20,27-29H2,3-8H3/t36?,40-,41-/m0/s1 |
| InChIKey | FJEDPOBSCVUIFA-MJPQJCIXSA-N |
| XLogP | 7.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.98 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|