C32H54O5SSi — CID 101088602
ethyl 2-[(1S,3aS,7aS)-4-(benzenesulfonyl)-7a-methyl-4-(4-methyl-4-triethylsilyloxypentyl)-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]acetate (PubChem CID 101088602) has the molecular formula C32H54O5SSi and a molecular weight of 578.93 g/mol. Its IUPAC name is ethyl 2-[(1S,3aS,7aS)-4-(benzenesulfonyl)-7a-methyl-4-(4-methyl-4-triethylsilyloxypentyl)-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,3aS,7aS)-4-(benzenesulfonyl)-7a-methyl-4-(4-methyl-4-triethylsilyloxypentyl)-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 101088602 |
| Molecular Formula | C32H54O5SSi |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | ethyl 2-[(1S,3aS,7aS)-4-(benzenesulfonyl)-7a-methyl-4-(4-methyl-4-triethylsilyloxypentyl)-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@@H]2C(CCCC(C)(C)O[Si](CC)(CC)CC)(S(=O)(=O)c3ccccc3)CCC[C@@]12C |
| InChI | InChI=1S/C32H54O5SSi/c1-8-36-29(33)25-26-19-20-28-31(26,7)22-16-24-32(28,38(34,35)27-17-13-12-14-18-27)23-15-21-30(5,6)37-39(9-2,10-3)11-4/h12-14,17-18,26,28H,8-11,15-16,19-25H2,1-7H3/t26-,28-,31-,32?/m0/s1 |
| InChIKey | JBXGYCWPCBIOSF-OATABOGNSA-N |
| XLogP | 8.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|