C24H30O8S — CID 134947947
2-O,2-O'-diethyl 4-O-methyl (3aS,4S,5R,7aR)-5-(benzenesulfonyl)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4-tricarboxylate (PubChem CID 134947947) has the molecular formula C24H30O8S and a molecular weight of 478.56 g/mol. Its IUPAC name is 2-O,2-O'-diethyl 4-O-methyl (3aS,4S,5R,7aR)-5-(benzenesulfonyl)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4-tricarboxylate.
| Compound Name | 2-O,2-O'-diethyl 4-O-methyl (3aS,4S,5R,7aR)-5-(benzenesulfonyl)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4-tricarboxylate |
|---|---|
| PubChem CID | 134947947 |
| Molecular Formula | C24H30O8S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-O,2-O'-diethyl 4-O-methyl (3aS,4S,5R,7aR)-5-(benzenesulfonyl)-7-methylidene-3,3a,4,5,6,7a-hexahydro-1H-indene-2,2,4-tricarboxylate |
| SMILES | C=C1C[C@@H](S(=O)(=O)c2ccccc2)[C@H](C(=O)OC)[C@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C24H30O8S/c1-5-31-22(26)24(23(27)32-6-2)13-17-15(3)12-19(20(18(17)14-24)21(25)30-4)33(28,29)16-10-8-7-9-11-16/h7-11,17-20H,3,5-6,12-14H2,1-2,4H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | VDPYFGHVLLIIEX-VNTMZGSJSA-N |
| XLogP | 2.72 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|