C36H40O10S2 — CID 134840809
12-O-ethyl 16-O,16-O'-dimethyl (10S,12R,13R)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,12,13,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-12,16,16-tricarboxylate (PubChem CID 134840809) has the molecular formula C36H40O10S2 and a molecular weight of 696.84 g/mol. Its IUPAC name is 12-O-ethyl 16-O,16-O'-dimethyl (10S,12R,13R)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,12,13,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-12,16,16-tricarboxylate.
| Compound Name | 12-O-ethyl 16-O,16-O'-dimethyl (10S,12R,13R)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,12,13,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-12,16,16-tricarboxylate |
|---|---|
| PubChem CID | 134840809 |
| Molecular Formula | C36H40O10S2 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 12-O-ethyl 16-O,16-O'-dimethyl (10S,12R,13R)-2,2-bis(benzenesulfonyl)-3,6,7,10,11,12,13,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-12,16,16-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2=C(CCC3=CCC(S(=O)(=O)c4ccccc4)(S(=O)(=O)c4ccccc4)C[C@@H]32)C2CC(C(=O)OC)(C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C36H40O10S2/c1-4-46-32(37)28-19-27-26(30-20-35(21-31(28)30,33(38)44-2)34(39)45-3)16-15-23-17-18-36(22-29(23)27,47(40,41)24-11-7-5-8-12-24)48(42,43)25-13-9-6-10-14-25/h5-14,17,28-31H,4,15-16,18-22H2,1-3H3/t28-,29+,30?,31+/m1/s1 |
| InChIKey | BILBMBQUZDVXPR-MZYSEHNVSA-N |
| XLogP | 5.00 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|