C27H28O8S2 — CID 102289012
diethyl 2-[2,2-bis(benzenesulfonyl)-1-phenylethyl]propanedioate (PubChem CID 102289012) has the molecular formula C27H28O8S2 and a molecular weight of 544.65 g/mol. Its IUPAC name is diethyl 2-[2,2-bis(benzenesulfonyl)-1-phenylethyl]propanedioate.
| Compound Name | diethyl 2-[2,2-bis(benzenesulfonyl)-1-phenylethyl]propanedioate |
|---|---|
| PubChem CID | 102289012 |
| Molecular Formula | C27H28O8S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | diethyl 2-[2,2-bis(benzenesulfonyl)-1-phenylethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(c1ccccc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28O8S2/c1-3-34-25(28)24(26(29)35-4-2)23(20-14-8-5-9-15-20)27(36(30,31)21-16-10-6-11-17-21)37(32,33)22-18-12-7-13-19-22/h5-19,23-24,27H,3-4H2,1-2H3 |
| InChIKey | JDZARHHAGJBCBU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|