C25H21F3O6S2 — CID 139256350
methyl 4,4-bis(benzenesulfonyl)-2-methylidene-3-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 139256350) has the molecular formula C25H21F3O6S2 and a molecular weight of 538.57 g/mol. Its IUPAC name is methyl 4,4-bis(benzenesulfonyl)-2-methylidene-3-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 4,4-bis(benzenesulfonyl)-2-methylidene-3-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 139256350 |
| Molecular Formula | C25H21F3O6S2 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | methyl 4,4-bis(benzenesulfonyl)-2-methylidene-3-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | C=C(C(=O)OC)C(c1ccc(C(F)(F)F)cc1)C(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H21F3O6S2/c1-17(23(29)34-2)22(18-13-15-19(16-14-18)25(26,27)28)24(35(30,31)20-9-5-3-6-10-20)36(32,33)21-11-7-4-8-12-21/h3-16,22,24H,1H2,2H3 |
| InChIKey | NKAASNLYGWCEAU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|