C22H30O8S — CID 10095485
cis-diethyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate (PubChem CID 10095485) has the molecular formula C22H30O8S and a molecular weight of 454.54 g/mol. Its IUPAC name is cis-diethyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10095485 |
| Molecular Formula | C22H30O8S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | cis-diethyl (3S,4S)-3-(2-methoxy-2-oxoethyl)-4-[(4-methylphenyl)sulfonylmethyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](CC(=O)OC)[C@@H](CS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H30O8S/c1-5-29-20(24)22(21(25)30-6-2)12-16(11-19(23)28-4)17(13-22)14-31(26,27)18-9-7-15(3)8-10-18/h7-10,16-17H,5-6,11-14H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | QCEGLPXGEFGQDD-IAGOWNOFSA-N |
| XLogP | 2.47 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|