C18H23F3O4S — CID 58291922
ethyl 1-methyl-4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylate (PubChem CID 58291922) has the molecular formula C18H23F3O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is ethyl 1-methyl-4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 1-methyl-4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58291922 |
| Molecular Formula | C18H23F3O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | ethyl 1-methyl-4-[[4-(trifluoromethyl)phenyl]sulfonylmethyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(CS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H23F3O4S/c1-3-25-16(22)17(2)10-8-13(9-11-17)12-26(23,24)15-6-4-14(5-7-15)18(19,20)21/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | VRKFLEAVPFIKJM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |