C21H25FO4S — CID 154713336
[(2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropyl] acetate (PubChem CID 154713336) has the molecular formula C21H25FO4S and a molecular weight of 392.49 g/mol. Its IUPAC name is [(2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropyl] acetate.
| Compound Name | [(2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropyl] acetate |
|---|---|
| PubChem CID | 154713336 |
| Molecular Formula | C21H25FO4S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [(2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropyl] acetate |
| SMILES | CC(=O)OC[C@H]([C@@H](F)c1ccccc1)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25FO4S/c1-15(23)26-14-19(20(22)16-8-6-5-7-9-16)27(24,25)18-12-10-17(11-13-18)21(2,3)4/h5-13,19-20H,14H2,1-4H3/t19-,20+/m1/s1 |
| InChIKey | WJLRCYCQWTXBKS-UXHICEINSA-N |
| XLogP | 4.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |