C20H25FO3S — CID 154713337
(3R,4S)-3-(4-tert-butylphenyl)sulfonyl-4-fluoro-4-phenylbutan-1-ol (PubChem CID 154713337) has the molecular formula C20H25FO3S and a molecular weight of 364.48 g/mol. Its IUPAC name is (3R,4S)-3-(4-tert-butylphenyl)sulfonyl-4-fluoro-4-phenylbutan-1-ol.
| Compound Name | (3R,4S)-3-(4-tert-butylphenyl)sulfonyl-4-fluoro-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 154713337 |
| Molecular Formula | C20H25FO3S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (3R,4S)-3-(4-tert-butylphenyl)sulfonyl-4-fluoro-4-phenylbutan-1-ol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)[C@H](CCO)[C@@H](F)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25FO3S/c1-20(2,3)16-9-11-17(12-10-16)25(23,24)18(13-14-22)19(21)15-7-5-4-6-8-15/h4-12,18-19,22H,13-14H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | NKQXWGKIRLSTAY-MOPGFXCFSA-N |
| XLogP | 4.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |