C19H23FO3S — CID 154713335
(2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropan-1-ol (PubChem CID 154713335) has the molecular formula C19H23FO3S and a molecular weight of 350.45 g/mol. Its IUPAC name is (2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropan-1-ol.
| Compound Name | (2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 154713335 |
| Molecular Formula | C19H23FO3S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (2R,3S)-2-(4-tert-butylphenyl)sulfonyl-3-fluoro-3-phenylpropan-1-ol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)[C@H](CO)[C@@H](F)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23FO3S/c1-19(2,3)15-9-11-16(12-10-15)24(22,23)17(13-21)18(20)14-7-5-4-6-8-14/h4-12,17-18,21H,13H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | DBCXEPPKTOBYHR-MSOLQXFVSA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |