C15H17F3O4S — CID 11325558
ethyl 2-methylsulfonyl-3-[4-(trifluoromethyl)phenyl]pent-4-enoate (PubChem CID 11325558) has the molecular formula C15H17F3O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is ethyl 2-methylsulfonyl-3-[4-(trifluoromethyl)phenyl]pent-4-enoate.
| Compound Name | ethyl 2-methylsulfonyl-3-[4-(trifluoromethyl)phenyl]pent-4-enoate |
|---|---|
| PubChem CID | 11325558 |
| Molecular Formula | C15H17F3O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | ethyl 2-methylsulfonyl-3-[4-(trifluoromethyl)phenyl]pent-4-enoate |
| SMILES | C=CC(c1ccc(C(F)(F)F)cc1)C(C(=O)OCC)S(C)(=O)=O |
| InChI | InChI=1S/C15H17F3O4S/c1-4-12(13(23(3,20)21)14(19)22-5-2)10-6-8-11(9-7-10)15(16,17)18/h4,6-9,12-13H,1,5H2,2-3H3 |
| InChIKey | DSVPWWPHHHMDKT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|