C25H25FO6S2 — CID 44634103
diethyl (2S,4R,6R,7S)-7-(4-fluorophenyl)-5,5-dioxo-2-phenyl-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-4,6-dicarboxylate (PubChem CID 44634103) has the molecular formula C25H25FO6S2 and a molecular weight of 504.60 g/mol. Its IUPAC name is diethyl (2S,4R,6R,7S)-7-(4-fluorophenyl)-5,5-dioxo-2-phenyl-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-4,6-dicarboxylate.
| Compound Name | diethyl (2S,4R,6R,7S)-7-(4-fluorophenyl)-5,5-dioxo-2-phenyl-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-4,6-dicarboxylate |
|---|---|
| PubChem CID | 44634103 |
| Molecular Formula | C25H25FO6S2 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | diethyl (2S,4R,6R,7S)-7-(4-fluorophenyl)-5,5-dioxo-2-phenyl-3,4,6,7-tetrahydro-2H-thieno[3,2-c]thiopyran-4,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C2=C(S[C@H](c3ccccc3)C2)[C@@H](c2ccc(F)cc2)[C@H](C(=O)OCC)S1(=O)=O |
| InChI | InChI=1S/C25H25FO6S2/c1-3-31-24(27)22-18-14-19(15-8-6-5-7-9-15)33-21(18)20(16-10-12-17(26)13-11-16)23(34(22,29)30)25(28)32-4-2/h5-13,19-20,22-23H,3-4,14H2,1-2H3/t19-,20+,22+,23+/m0/s1 |
| InChIKey | DVDIQTRQGAWGPG-KKSHJYNMSA-N |
| XLogP | 4.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |