C12H13FO4S — CID 135065837
methyl (2S,3R)-3-(4-fluorophenyl)-1,1-dioxothiolane-2-carboxylate (PubChem CID 135065837) has the molecular formula C12H13FO4S and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (2S,3R)-3-(4-fluorophenyl)-1,1-dioxothiolane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-(4-fluorophenyl)-1,1-dioxothiolane-2-carboxylate |
|---|---|
| PubChem CID | 135065837 |
| Molecular Formula | C12H13FO4S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl (2S,3R)-3-(4-fluorophenyl)-1,1-dioxothiolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccc(F)cc2)CCS1(=O)=O |
| InChI | InChI=1S/C12H13FO4S/c1-17-12(14)11-10(6-7-18(11,15)16)8-2-4-9(13)5-3-8/h2-5,10-11H,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | LOMBCINOSXXDNH-MNOVXSKESA-N |
| XLogP | 1.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |