C23H34O4S — CID 11384230
methyl (5S)-5-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate (PubChem CID 11384230) has the molecular formula C23H34O4S and a molecular weight of 406.59 g/mol. Its IUPAC name is methyl (5S)-5-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate.
| Compound Name | methyl (5S)-5-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
|---|---|
| PubChem CID | 11384230 |
| Molecular Formula | C23H34O4S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl (5S)-5-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
| SMILES | COC(=O)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H](S(=O)(=O)c3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C23H34O4S/c1-17(9-7-13-22(24)27-3)19-14-15-20-21(12-8-16-23(19,20)2)28(25,26)18-10-5-4-6-11-18/h4-6,10-11,17,19-21H,7-9,12-16H2,1-3H3/t17-,19-,20+,21-,23-/m0/s1 |
| InChIKey | NQECXHOYTAACLZ-BYGOBXPBSA-N |
| XLogP | 5.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |