C22H28O4S — CID 11036524
3-(4-methylphenyl)sulfonylprop-2-ynyl (3aS,7S,7aR)-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate (PubChem CID 11036524) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonylprop-2-ynyl (3aS,7S,7aR)-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate.
| Compound Name | 3-(4-methylphenyl)sulfonylprop-2-ynyl (3aS,7S,7aR)-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate |
|---|---|
| PubChem CID | 11036524 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-(4-methylphenyl)sulfonylprop-2-ynyl (3aS,7S,7aR)-7,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroindene-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)C#CCOC(=O)C2C[C@@H]3CCC[C@H](C)[C@@]3(C)C2)cc1 |
| InChI | InChI=1S/C22H28O4S/c1-16-8-10-20(11-9-16)27(24,25)13-5-12-26-21(23)18-14-19-7-4-6-17(2)22(19,3)15-18/h8-11,17-19H,4,6-7,12,14-15H2,1-3H3/t17-,18?,19-,22+/m0/s1 |
| InChIKey | UOGYTNQJTPBDDB-ICHYPFNWSA-N |
| XLogP | 4.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|