C21H30O4S — CID 100974764
ethyl (2S)-2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propanoate (PubChem CID 100974764) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is ethyl (2S)-2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propanoate.
| Compound Name | ethyl (2S)-2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propanoate |
|---|---|
| PubChem CID | 100974764 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethyl (2S)-2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@@H]1CC[C@@H]2[C@@H](S(=O)(=O)c3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C21H30O4S/c1-4-25-20(22)15(2)17-12-13-18-19(11-8-14-21(17,18)3)26(23,24)16-9-6-5-7-10-16/h5-7,9-10,15,17-19H,4,8,11-14H2,1-3H3/t15-,17-,18+,19-,21-/m0/s1 |
| InChIKey | KIXZRCSIBZTVNC-CBHOWOPOSA-N |
| XLogP | 4.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |