C33H52O6S — CID 10769507
methyl 3-[(1R,3aS,4S,5S,7aR)-5-[(3R,5S)-5-(benzenesulfonylmethyl)-3-methyldioxolan-3-yl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate (PubChem CID 10769507) has the molecular formula C33H52O6S and a molecular weight of 576.84 g/mol. Its IUPAC name is methyl 3-[(1R,3aS,4S,5S,7aR)-5-[(3R,5S)-5-(benzenesulfonylmethyl)-3-methyldioxolan-3-yl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate.
| Compound Name | methyl 3-[(1R,3aS,4S,5S,7aR)-5-[(3R,5S)-5-(benzenesulfonylmethyl)-3-methyldioxolan-3-yl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate |
|---|---|
| PubChem CID | 10769507 |
| Molecular Formula | C33H52O6S |
| Molecular Weight | 576.84 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | methyl 3-[(1R,3aS,4S,5S,7aR)-5-[(3R,5S)-5-(benzenesulfonylmethyl)-3-methyldioxolan-3-yl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1[C@@H]2CC[C@H]([C@H](C)CCCC(C)C)[C@@]2(C)CC[C@@H]1[C@@]1(C)C[C@@H](CS(=O)(=O)c2ccccc2)OO1 |
| InChI | InChI=1S/C33H52O6S/c1-23(2)11-10-12-24(3)28-16-17-29-27(15-18-31(34)37-6)30(19-20-32(28,29)4)33(5)21-25(38-39-33)22-40(35,36)26-13-8-7-9-14-26/h7-9,13-14,23-25,27-30H,10-12,15-22H2,1-6H3/t24-,25+,27+,28-,29+,30+,32-,33-/m1/s1 |
| InChIKey | UZWPZSALNJLXGP-JTMMYIRCSA-N |
| XLogP | 7.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.84 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|