C31H42O5S — CID 134982790
methyl (4R)-4-(benzenesulfonyl)-4-[(1S,2R,5R,7R,8R,10R,11S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]butanoate (PubChem CID 134982790) has the molecular formula C31H42O5S and a molecular weight of 526.74 g/mol. Its IUPAC name is methyl (4R)-4-(benzenesulfonyl)-4-[(1S,2R,5R,7R,8R,10R,11S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]butanoate.
| Compound Name | methyl (4R)-4-(benzenesulfonyl)-4-[(1S,2R,5R,7R,8R,10R,11S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]butanoate |
|---|---|
| PubChem CID | 134982790 |
| Molecular Formula | C31H42O5S |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | methyl (4R)-4-(benzenesulfonyl)-4-[(1S,2R,5R,7R,8R,10R,11S,15S)-8-methoxy-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadec-13-enyl]butanoate |
| SMILES | COC(=O)CC[C@H](C1=CC[C@H]2[C@@H]3C[C@@H](OC)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H42O5S/c1-29-16-15-24-22(18-27(35-3)31-19-20(31)14-17-30(24,31)2)23(29)10-11-25(29)26(12-13-28(32)36-4)37(33,34)21-8-6-5-7-9-21/h5-9,11,20,22-24,26-27H,10,12-19H2,1-4H3/t20-,22+,23+,24+,26-,27-,29+,30-,31+/m1/s1 |
| InChIKey | UQOSOBMPLRCBOR-KEYUWIOXSA-N |
| XLogP | 5.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|