C31H42F2O5S — CID 163297748
[(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-(benzenesulfonyl)-6,6-difluorohexanoate (PubChem CID 163297748) has the molecular formula C31H42F2O5S and a molecular weight of 564.74 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-(benzenesulfonyl)-6,6-difluorohexanoate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-(benzenesulfonyl)-6,6-difluorohexanoate |
|---|---|
| PubChem CID | 163297748 |
| Molecular Formula | C31H42F2O5S |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] 6-(benzenesulfonyl)-6,6-difluorohexanoate |
| SMILES | C[C@]12CC[C@H](OC(=O)CCCCC(F)(F)S(=O)(=O)c3ccccc3)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C31H42F2O5S/c1-29-18-15-22(20-21(29)11-12-24-25-13-14-27(34)30(25,2)19-16-26(24)29)38-28(35)10-6-7-17-31(32,33)39(36,37)23-8-4-3-5-9-23/h3-5,8-9,21-22,24-26H,6-7,10-20H2,1-2H3/t21-,22-,24-,25-,26-,29-,30-/m0/s1 |
| InChIKey | ABDSBLIBYZTYFA-VVDNQCRQSA-N |
| XLogP | 7.14 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|