C20H28O4S — CID 101088600
ethyl 2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]acetate (PubChem CID 101088600) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is ethyl 2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]acetate.
| Compound Name | ethyl 2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]acetate |
|---|---|
| PubChem CID | 101088600 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | ethyl 2-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@@H]2[C@@H](S(=O)(=O)c3ccccc3)CCC[C@@]12C |
| InChI | InChI=1S/C20H28O4S/c1-3-24-19(21)14-15-11-12-17-18(10-7-13-20(15,17)2)25(22,23)16-8-5-4-6-9-16/h4-6,8-9,15,17-18H,3,7,10-14H2,1-2H3/t15-,17+,18-,20-/m0/s1 |
| InChIKey | UPUFKIZSLRDPSC-NFBUACBFSA-N |
| XLogP | 4.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |