C32H48O4SSi — CID 173313528
[7-[6-(benzenesulfinyl)hexa-2,3-dienyl]-5-tert-butyl-1-dimethylsilyl-3,6,7a-trimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate (PubChem CID 173313528) has the molecular formula C32H48O4SSi and a molecular weight of 556.89 g/mol. Its IUPAC name is [7-[6-(benzenesulfinyl)hexa-2,3-dienyl]-5-tert-butyl-1-dimethylsilyl-3,6,7a-trimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate.
| Compound Name | [7-[6-(benzenesulfinyl)hexa-2,3-dienyl]-5-tert-butyl-1-dimethylsilyl-3,6,7a-trimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate |
|---|---|
| PubChem CID | 173313528 |
| Molecular Formula | C32H48O4SSi |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | [7-[6-(benzenesulfinyl)hexa-2,3-dienyl]-5-tert-butyl-1-dimethylsilyl-3,6,7a-trimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1H-inden-4-yl] acetate |
| SMILES | CC(=O)OC1C(C(C)(C)C)C(C)C(CC=C=CCCS(=O)c2ccccc2)C2(C)C1C(C)C(=O)C2[SiH](C)C |
| InChI | InChI=1S/C32H48O4SSi/c1-21-25(19-15-10-11-16-20-37(35)24-17-13-12-14-18-24)32(7)27(22(2)28(34)30(32)38(8)9)29(36-23(3)33)26(21)31(4,5)6/h11-15,17-18,21-22,25-27,29-30,38H,16,19-20H2,1-9H3 |
| InChIKey | FDWFHLMNYFRMHQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|