C38H70O5SSi2 — CID 11146868
(2S,3R,4S,10R,11S,14S)-1-(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-one (PubChem CID 11146868) has the molecular formula C38H70O5SSi2 and a molecular weight of 695.21 g/mol. Its IUPAC name is (2S,3R,4S,10R,11S,14S)-1-(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-one.
| Compound Name | (2S,3R,4S,10R,11S,14S)-1-(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-one |
|---|---|
| PubChem CID | 11146868 |
| Molecular Formula | C38H70O5SSi2 |
| Molecular Weight | 695.21 g/mol |
| Exact Mass | 694.45 |
| IUPAC Name | (2S,3R,4S,10R,11S,14S)-1-(benzenesulfonyl)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,10,14-tetramethylhexadec-15-en-7-one |
| SMILES | C=C[C@@H](C)CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCC(=O)CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H70O5SSi2/c1-16-29(2)22-27-35(42-45(12,13)37(6,7)8)30(3)23-25-33(39)26-24-31(4)36(43-46(14,15)38(9,10)11)32(5)28-44(40,41)34-20-18-17-19-21-34/h16-21,29-32,35-36H,1,22-28H2,2-15H3/t29-,30-,31+,32-,35+,36-/m1/s1 |
| InChIKey | AEEVPEBVRJVPIA-NPJULQCTSA-N |
| XLogP | 10.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.21 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|