C31H58O6SSi2 — CID 11479054
(7S,9R,10R)-1-(benzenesulfonyl)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,2-dimethylundecan-3-one (PubChem CID 11479054) has the molecular formula C31H58O6SSi2 and a molecular weight of 615.04 g/mol. Its IUPAC name is (7S,9R,10R)-1-(benzenesulfonyl)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,2-dimethylundecan-3-one.
| Compound Name | (7S,9R,10R)-1-(benzenesulfonyl)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,2-dimethylundecan-3-one |
|---|---|
| PubChem CID | 11479054 |
| Molecular Formula | C31H58O6SSi2 |
| Molecular Weight | 615.04 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | (7S,9R,10R)-1-(benzenesulfonyl)-9,10-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-2,2-dimethylundecan-3-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@@H](O)CCCC(=O)C(C)(C)CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H58O6SSi2/c1-24(36-39(10,11)29(2,3)4)27(37-40(12,13)30(5,6)7)22-25(32)18-17-21-28(33)31(8,9)23-38(34,35)26-19-15-14-16-20-26/h14-16,19-20,24-25,27,32H,17-18,21-23H2,1-13H3/t24-,25+,27-/m1/s1 |
| InChIKey | AQIOSMJKFIYNMG-CMTIAEDTSA-N |
| XLogP | 7.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.04 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|