C26H46O5SSi — CID 11504246
6-(benzenesulfonyl)-14-[tert-butyl(dimethyl)silyl]oxy-2-hydroxytetradecan-5-one (PubChem CID 11504246) has the molecular formula C26H46O5SSi and a molecular weight of 498.80 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-14-[tert-butyl(dimethyl)silyl]oxy-2-hydroxytetradecan-5-one.
| Compound Name | 6-(benzenesulfonyl)-14-[tert-butyl(dimethyl)silyl]oxy-2-hydroxytetradecan-5-one |
|---|---|
| PubChem CID | 11504246 |
| Molecular Formula | C26H46O5SSi |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 6-(benzenesulfonyl)-14-[tert-butyl(dimethyl)silyl]oxy-2-hydroxytetradecan-5-one |
| SMILES | CC(O)CCC(=O)C(CCCCCCCCO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H46O5SSi/c1-22(27)19-20-24(28)25(32(29,30)23-16-12-11-13-17-23)18-14-9-7-8-10-15-21-31-33(5,6)26(2,3)4/h11-13,16-17,22,25,27H,7-10,14-15,18-21H2,1-6H3 |
| InChIKey | CCZRMJXUWNFBOO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|