C26H46O7SSi — CID 134878945
(8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one (PubChem CID 134878945) has the molecular formula C26H46O7SSi and a molecular weight of 530.80 g/mol. Its IUPAC name is (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one.
| Compound Name | (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one |
|---|---|
| PubChem CID | 134878945 |
| Molecular Formula | C26H46O7SSi |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (8S,9S)-6-(benzenesulfonyl)-10-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-9-(methoxymethoxy)-4,8-dimethyldecan-5-one |
| SMILES | COCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)CC(C(=O)C(C)CCCO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H46O7SSi/c1-20(13-12-16-27)25(28)24(34(29,30)22-14-10-9-11-15-22)17-21(2)23(32-19-31-6)18-33-35(7,8)26(3,4)5/h9-11,14-15,20-21,23-24,27H,12-13,16-19H2,1-8H3/t20?,21-,23+,24?/m0/s1 |
| InChIKey | OWOJJTSSNOQYOP-IIMZJVOLSA-N |
| XLogP | 4.84 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|