C22H36O5SSi — CID 11476200
2-[(2R,4S,6R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-6-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]acetaldehyde (PubChem CID 11476200) has the molecular formula C22H36O5SSi and a molecular weight of 440.68 g/mol. Its IUPAC name is 2-[(2R,4S,6R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-6-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]acetaldehyde.
| Compound Name | 2-[(2R,4S,6R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-6-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11476200 |
| Molecular Formula | C22H36O5SSi |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[(2R,4S,6R)-2-[(2S)-1-(benzenesulfonyl)propan-2-yl]-6-[tert-butyl(dimethyl)silyl]oxyoxan-4-yl]acetaldehyde |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1C[C@@H](CC=O)C[C@@H](O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H36O5SSi/c1-17(16-28(24,25)19-10-8-7-9-11-19)20-14-18(12-13-23)15-21(26-20)27-29(5,6)22(2,3)4/h7-11,13,17-18,20-21H,12,14-16H2,1-6H3/t17-,18-,20-,21-/m1/s1 |
| InChIKey | COOXFKWABWKDFK-VURPSTOHSA-N |
| XLogP | 4.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|