C40H76O7SSi2 — CID 10887180
(2S,6S,8R,9R)-3-(benzenesulfonyl)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5S)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-ol (PubChem CID 10887180) has the molecular formula C40H76O7SSi2 and a molecular weight of 757.28 g/mol. Its IUPAC name is (2S,6S,8R,9R)-3-(benzenesulfonyl)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5S)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-ol.
| Compound Name | (2S,6S,8R,9R)-3-(benzenesulfonyl)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5S)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-ol |
|---|---|
| PubChem CID | 10887180 |
| Molecular Formula | C40H76O7SSi2 |
| Molecular Weight | 757.28 g/mol |
| Exact Mass | 756.49 |
| IUPAC Name | (2S,6S,8R,9R)-3-(benzenesulfonyl)-8,9-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4R,5S)-2,2-dimethyl-5-propan-2-yl-1,3-dioxolan-4-yl]-2,6,10-trimethylundecan-4-ol |
| SMILES | CC(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@@H](C)CC(O)C([C@@H](C)C[C@H]1OC(C)(C)O[C@H]1C(C)C)S(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H76O7SSi2/c1-27(2)35-33(44-40(13,14)45-35)26-30(6)37(48(42,43)31-22-20-19-21-23-31)32(41)24-29(5)25-34(46-49(15,16)38(7,8)9)36(28(3)4)47-50(17,18)39(10,11)12/h19-23,27-30,32-37,41H,24-26H2,1-18H3/t29-,30-,32?,33+,34+,35-,36+,37?/m0/s1 |
| InChIKey | OSIXZALKWMQSSH-MANRENQWSA-N |
| XLogP | 10.25 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.28 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|