C32H60O7SSi2 — CID 11787051
(2S,3S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methoxyoxan-3-ol (PubChem CID 11787051) has the molecular formula C32H60O7SSi2 and a molecular weight of 645.06 g/mol. Its IUPAC name is (2S,3S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methoxyoxan-3-ol.
| Compound Name | (2S,3S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methoxyoxan-3-ol |
|---|---|
| PubChem CID | 11787051 |
| Molecular Formula | C32H60O7SSi2 |
| Molecular Weight | 645.06 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | (2S,3S,6S)-2-[1-(benzenesulfonyl)-2-methylpropan-2-yl]-6-[(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-2-methoxyoxan-3-ol |
| SMILES | CO[C@@]1(C(C)(C)CS(=O)(=O)c2ccccc2)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1O |
| InChI | InChI=1S/C32H60O7SSi2/c1-24(38-41(11,12)29(2,3)4)27(39-42(13,14)30(5,6)7)22-25-20-21-28(33)32(36-10,37-25)31(8,9)23-40(34,35)26-18-16-15-17-19-26/h15-19,24-25,27-28,33H,20-23H2,1-14H3/t24-,25+,27-,28+,32-/m1/s1 |
| InChIKey | NMYIJEPBRFGYAJ-MKHSYKJOSA-N |
| XLogP | 7.56 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.06 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|