C20H34O6SSi — CID 134931697
[(2R,3R,4R,6S)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxyoxan-2-yl]methanol (PubChem CID 134931697) has the molecular formula C20H34O6SSi and a molecular weight of 430.64 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,6S)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 134931697 |
| Molecular Formula | C20H34O6SSi |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [(2R,3R,4R,6S)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-ethoxyoxan-2-yl]methanol |
| SMILES | CCO[C@@H]1[C@@H](CO)O[C@@H](S(=O)(=O)c2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6SSi/c1-7-24-19-16(26-28(5,6)20(2,3)4)13-18(25-17(19)14-21)27(22,23)15-11-9-8-10-12-15/h8-12,16-19,21H,7,13-14H2,1-6H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | YUUFLJIMQQZXDE-YRXWBPOGSA-N |
| XLogP | 3.36 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|