C13H18O4S — CID 11300216
(2S,3S,4S,5R,6S)-5-methoxy-6-methyl-2-phenylsulfanyloxane-3,4-diol (PubChem CID 11300216) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-5-methoxy-6-methyl-2-phenylsulfanyloxane-3,4-diol.
| Compound Name | (2S,3S,4S,5R,6S)-5-methoxy-6-methyl-2-phenylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 11300216 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2S,3S,4S,5R,6S)-5-methoxy-6-methyl-2-phenylsulfanyloxane-3,4-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](O)[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C13H18O4S/c1-8-12(16-2)10(14)11(15)13(17-8)18-9-6-4-3-5-7-9/h3-8,10-15H,1-2H3/t8-,10-,11-,12-,13-/m0/s1 |
| InChIKey | IGTWNVYIZWZFQQ-ALQCUDPJSA-N |
| XLogP | 1.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |