C31H54O5SSi2 — CID 10974014
(8R,9S,10R)-11-(benzenesulfonyl)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-8,10-dimethylundec-3-yn-5-one (PubChem CID 10974014) has the molecular formula C31H54O5SSi2 and a molecular weight of 595.01 g/mol. Its IUPAC name is (8R,9S,10R)-11-(benzenesulfonyl)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-8,10-dimethylundec-3-yn-5-one.
| Compound Name | (8R,9S,10R)-11-(benzenesulfonyl)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-8,10-dimethylundec-3-yn-5-one |
|---|---|
| PubChem CID | 10974014 |
| Molecular Formula | C31H54O5SSi2 |
| Molecular Weight | 595.01 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (8R,9S,10R)-11-(benzenesulfonyl)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-8,10-dimethylundec-3-yn-5-one |
| SMILES | C[C@H](CCC(=O)C#CCCO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H54O5SSi2/c1-25(21-22-27(32)18-16-17-23-35-38(9,10)30(3,4)5)29(36-39(11,12)31(6,7)8)26(2)24-37(33,34)28-19-14-13-15-20-28/h13-15,19-20,25-26,29H,17,21-24H2,1-12H3/t25-,26+,29+/m1/s1 |
| InChIKey | YMVSWTXCLVCNKL-ALTZYDRJSA-N |
| XLogP | 7.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.01 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|