C25H42O4SSi — CID 10552185
(5R,6S,7S)-9-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,5,7-tetramethylnon-1-en-4-one (PubChem CID 10552185) has the molecular formula C25H42O4SSi and a molecular weight of 466.76 g/mol. Its IUPAC name is (5R,6S,7S)-9-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,5,7-tetramethylnon-1-en-4-one.
| Compound Name | (5R,6S,7S)-9-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,5,7-tetramethylnon-1-en-4-one |
|---|---|
| PubChem CID | 10552185 |
| Molecular Formula | C25H42O4SSi |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | (5R,6S,7S)-9-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-3,3,5,7-tetramethylnon-1-en-4-one |
| SMILES | C=CC(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H42O4SSi/c1-11-25(7,8)23(26)20(3)22(29-31(9,10)24(4,5)6)19(2)17-18-30(27,28)21-15-13-12-14-16-21/h11-16,19-20,22H,1,17-18H2,2-10H3/t19-,20+,22-/m0/s1 |
| InChIKey | BHUQKIYJMMUQJE-VWPQPMDRSA-N |
| XLogP | 6.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|