C18H28O4SSi — CID 11068612
(2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentan-1-one (PubChem CID 11068612) has the molecular formula C18H28O4SSi and a molecular weight of 368.57 g/mol. Its IUPAC name is (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentan-1-one.
| Compound Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 11068612 |
| Molecular Formula | C18H28O4SSi |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2R,3S,4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclopentan-1-one |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O4SSi/c1-13-16(22-24(5,6)18(2,3)4)12-15(19)17(13)23(20,21)14-10-8-7-9-11-14/h7-11,13,16-17H,12H2,1-6H3/t13-,16-,17+/m0/s1 |
| InChIKey | RUBFHRLXRXPIFC-RRQGHBQHSA-N |
| XLogP | 3.83 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|