C22H34O3SSi — CID 139608747
3-[tert-butyl(dimethyl)silyl]oxy-4-(3-ethoxy-1-phenylsulfanylprop-2-enyl)cyclopentan-1-one (PubChem CID 139608747) has the molecular formula C22H34O3SSi and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4-(3-ethoxy-1-phenylsulfanylprop-2-enyl)cyclopentan-1-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-(3-ethoxy-1-phenylsulfanylprop-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 139608747 |
| Molecular Formula | C22H34O3SSi |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-(3-ethoxy-1-phenylsulfanylprop-2-enyl)cyclopentan-1-one |
| SMILES | CCOC=CC(Sc1ccccc1)C1CC(=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O3SSi/c1-7-24-14-13-21(26-18-11-9-8-10-12-18)19-15-17(23)16-20(19)25-27(5,6)22(2,3)4/h8-14,19-21H,7,15-16H2,1-6H3 |
| InChIKey | GXWIKKLBSVFLLX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|