C20H32O2S — CID 134874868
5-methoxy-4-methyl-6-phenylsulfanyldodecan-3-one (PubChem CID 134874868) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is 5-methoxy-4-methyl-6-phenylsulfanyldodecan-3-one.
| Compound Name | 5-methoxy-4-methyl-6-phenylsulfanyldodecan-3-one |
|---|---|
| PubChem CID | 134874868 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 5-methoxy-4-methyl-6-phenylsulfanyldodecan-3-one |
| SMILES | CCCCCCC(Sc1ccccc1)C(OC)C(C)C(=O)CC |
| InChI | InChI=1S/C20H32O2S/c1-5-7-8-12-15-19(23-17-13-10-9-11-14-17)20(22-4)16(3)18(21)6-2/h9-11,13-14,16,19-20H,5-8,12,15H2,1-4H3 |
| InChIKey | NMBOHPOYZXODEP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|